cas: 48165-50-0 — see every product listed under this CAS number, including other names
Ni(phen)Br2 98% (CAS 48165-50-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1272891-1g |
| cas | 48165-50-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 565.06 Pln | |
| Ambeed | 25g | 1744.31 Pln | |
| Ambeed | 100g | 5098.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1272891 |
Dibromonickel;1,10-phenanthroline (CAS 48165-50-0) is a chemical compound with the molecular formula C12H8Br2N2Ni and a molecular weight of 398.71 g/mol. IUPAC name: dibromonickel;1,10-phenanthroline. InChIKey: XCUCYFXAOLWFSN-UHFFFAOYSA-L.
| Molecular formula | C12H8Br2N2Ni |
|---|---|
| Molecular weight | 398.71 g/mol |
| IUPAC name | dibromonickel;1,10-phenanthroline |
| InChIKey | XCUCYFXAOLWFSN-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[Ni](Br)Br |
Computed by PubChem (NCBI)