CAS 5579-89-5 appears in our catalog under these names: Nifursemizone (Etafurazone), Nifursemizone/ 99.17% (existing batch purity), Nifursemizone, 1-Ethyl-2-[(5-nitro-2-furanyl)methylene]hydrazinecarboxamide, 98%, 98%, Nifursemizone, 99.25%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
1-ethyl-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea (CAS 5579-89-5) is a chemical compound with the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. IUPAC name: 1-ethyl-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea. InChIKey: JGPNCLKRECLYTO-BJMVGYQFSA-N.
| Molecular formula | C8H10N4O4 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 1-ethyl-1-[(E)-(5-nitrofuran-2-yl)methylideneamino]urea |
| InChIKey | JGPNCLKRECLYTO-BJMVGYQFSA-N |
| SMILES | CCN(C(=O)N)/N=C/C1=CC=C(O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)