CAS 89059-37-0 appears in our catalog under these names: Nitrobenzene-13C6, >95% (HPLC), Nitrobenzene 13C6 100 µg/mL in Methanol, NITROBENZENE-13C6, 99 ATOM % 13C. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: 100mg, 10mg, 1ml, 500MG.
Nitro(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 89059-37-0) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 129.066 g/mol. IUPAC name: nitro(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: LQNUZADURLCDLV-IDEBNGHGSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 129.066 g/mol |
| IUPAC name | nitro(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | LQNUZADURLCDLV-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[N+](=O)[O-] |
Computed by PubChem (NCBI)