CAS 22346-73-2 is the registry number for 3-Formylpyridine 1-oxide, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
1-oxidopyridin-1-ium-3-carbaldehyde (CAS 22346-73-2) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 123.11 g/mol. IUPAC name: 1-oxidopyridin-1-ium-3-carbaldehyde. InChIKey: LNYJHQOHEHEMOO-UHFFFAOYSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 123.11 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-3-carbaldehyde |
| InChIKey | LNYJHQOHEHEMOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])C=O |
Computed by PubChem (NCBI)