CAS 1689-89-0 appears in our catalog under these names: Nitroxynil (Nitroxinil), Nitroxinil, >95% (HPLC), Nitroxynil, Nitroxynil 1000 µg/mL in Acetonitrile, Nitroxynil/ 99.85% (existing batch purity). Offered by: Chemat Brand, TRC, LoGiCal, Dr. Ehrenstorfer, TargetMol. Available pack sizes: on request, 10g, 1g, 10mg, 100mg, 1ml, 500mg, 0,25kg.
4-hydroxy-3-iodo-5-nitrobenzonitrile (CAS 1689-89-0) is a chemical compound with the molecular formula C7H3IN2O3 and a molecular weight of 290.01 g/mol. IUPAC name: 4-hydroxy-3-iodo-5-nitrobenzonitrile. InChIKey: SGKGVABHDAQAJO-UHFFFAOYSA-N.
| Molecular formula | C7H3IN2O3 |
|---|---|
| Molecular weight | 290.01 g/mol |
| IUPAC name | 4-hydroxy-3-iodo-5-nitrobenzonitrile |
| InChIKey | SGKGVABHDAQAJO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)I)C#N |
Computed by PubChem (NCBI)