CAS 147149-76-6 appears in our catalog under these names: Nolatrexed/ 97.91% (existing batch purity), Nolatrexed, 2-Amino-6-methyl-5-(pyridin-4-ylthio)quinazolin-4(3H)-one. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one (CAS 147149-76-6) is a chemical compound with the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. IUPAC name: 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one. InChIKey: XHWRWCSCBDLOLM-UHFFFAOYSA-N.
| Molecular formula | C14H12N4OS |
|---|---|
| Molecular weight | 284.34 g/mol |
| IUPAC name | 2-amino-6-methyl-5-pyridin-4-ylsulfanyl-3H-quinazolin-4-one |
| InChIKey | XHWRWCSCBDLOLM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=C(NC2=O)N)SC3=CC=NC=C3 |
Computed by PubChem (NCBI)