cas: 423-39-2 — see every product listed under this CAS number, including other names
Nonafluorobutyl Iodide, >98.0%(GC) (CAS 423-39-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0499-25G |
| cas | 423-39-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 182.27 Pln | |
| TCI | 100g | 526.48 Pln | |
| TCI | 500g | 1745.95 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane (CAS 423-39-2) is a chemical compound with the molecular formula C4F9I and a molecular weight of 345.93 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane. InChIKey: PGRFXXCKHGIFSV-UHFFFAOYSA-N.
| Molecular formula | C4F9I |
|---|---|
| Molecular weight | 345.93 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane |
| InChIKey | PGRFXXCKHGIFSV-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)