CAS 375-51-9 appears in our catalog under these names: 2-Iodononafluorobutane, 98%, 2–Iodononafluorobutane, 2-Iodononafluorobutane. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 25g, 1g, 5g, 100g.
1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane (CAS 375-51-9) is a chemical compound with the molecular formula C4F9I and a molecular weight of 345.93 g/mol. IUPAC name: 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane. InChIKey: FBJVLVWUMYWJMY-UHFFFAOYSA-N.
| Molecular formula | C4F9I |
|---|---|
| Molecular weight | 345.93 g/mol |
| IUPAC name | 1,1,1,2,2,3,4,4,4-nonafluoro-3-iodobutane |
| InChIKey | FBJVLVWUMYWJMY-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(F)I)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)