CAS 423-39-2 appears in our catalog under these names: Perfluorobutyl iodide, 95%, Perfluorobutyl Iodide, >95% (GC), Nonafluorobutyl Iodide, Nonafluoro-1-iodobutane, 97% , Nonafluorobutyl Iodide, >98.0%(GC). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 500g, 5g, 1g, 100g.
1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane (CAS 423-39-2) is a chemical compound with the molecular formula C4F9I and a molecular weight of 345.93 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane. InChIKey: PGRFXXCKHGIFSV-UHFFFAOYSA-N.
| Molecular formula | C4F9I |
|---|---|
| Molecular weight | 345.93 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane |
| InChIKey | PGRFXXCKHGIFSV-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)I)(F)F)(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)