Products 3035124-25-2
CAS 3035124-25-2 is the registry number for Nrf2-ARE/hMAO-B/QR2 modulator 1, 98.42%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10mM/1mL, 100 mg, 5 mg, 10 mg, 50 mg.
5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-prop-2-ynyl-1,3,4-oxadiazol-2-one (CAS 3035124-25-2) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-prop-2-ynyl-1,3,4-oxadiazol-2-one. InChIKey: SFKGQKWKUGEJCM-RMKNXTFCSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-prop-2-ynyl-1,3,4-oxadiazol-2-one |
| InChIKey | SFKGQKWKUGEJCM-RMKNXTFCSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=NN(C(=O)O2)CC#C |
Computed by PubChem (NCBI)