CAS 317321-41-8 appears in our catalog under these names: O-1602/ 99.4% (existing batch purity), O–1602, 5-Methyl-4-((1R,6R)-3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl)-1,3-benzenediol, O-1602, 99.85% ,, 99.85% ,, O-1602, 99.68%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2g, 1g.
5-methyl-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol (CAS 317321-41-8) is a chemical compound with the molecular formula C17H22O2 and a molecular weight of 258.35 g/mol. IUPAC name: 5-methyl-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol. InChIKey: KDZOUSULXZNDJH-LSDHHAIUSA-N.
| Molecular formula | C17H22O2 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | 5-methyl-4-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
| InChIKey | KDZOUSULXZNDJH-LSDHHAIUSA-N |
| SMILES | CC1=C[C@H]([C@@H](CC1)C(=C)C)C2=C(C=C(C=C2C)O)O |
Computed by PubChem (NCBI)