CAS 70877-75-7 appears in our catalog under these names: O-Desmethyl quinidine, 95%, O-Desmethyl Quinidine, >95% (HPLC), (9S)–Cinchonan–6',9–diol, O-Desmethyl Quinidine/ 100%, O-Desmethyl quinidine. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 10mg, 2,5mg, 25mg, 50mg, 500mg.
4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol (CAS 70877-75-7) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol. InChIKey: VJFMSYZSFUWQPZ-WXPXUSHHSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-hydroxymethyl]quinolin-6-ol |
| InChIKey | VJFMSYZSFUWQPZ-WXPXUSHHSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)O)O |
Computed by PubChem (NCBI)