cas: 5854-78-4 — see every product listed under this CAS number, including other names
O-tert-Butylthreoninetert-butyl ester, 99.97% (CAS 5854-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009648-100 g |
| cas | 5854-78-4 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 575.11 Pln | |
| MedChemExpress | 25 g | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
Tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate (CAS 5854-78-4) is a chemical compound with the molecular formula C12H25NO3 and a molecular weight of 231.33 g/mol. IUPAC name: tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate. InChIKey: PPDIUNOGUIAFLV-BDAKNGLRSA-N.
| Molecular formula | C12H25NO3 |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate |
| InChIKey | PPDIUNOGUIAFLV-BDAKNGLRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC(C)(C)C |
Computed by PubChem (NCBI)