cas: 5854-78-4 — see every product listed under this CAS number, including other names
(2S,3R)-tert-Butyl 2-amino-3-(tert-butoxy)butanoate, 95% (CAS 5854-78-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211467-5G |
| cas | 5854-78-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 284.29 Pln | |
| Fluorochem | 100g | 419.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate (CAS 5854-78-4) is a chemical compound with the molecular formula C12H25NO3 and a molecular weight of 231.33 g/mol. IUPAC name: tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate. InChIKey: PPDIUNOGUIAFLV-BDAKNGLRSA-N.
| Molecular formula | C12H25NO3 |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | tert-butyl (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoate |
| InChIKey | PPDIUNOGUIAFLV-BDAKNGLRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC(C)(C)C)N)OC(C)(C)C |
Computed by PubChem (NCBI)