CAS 300586-90-7 appears in our catalog under these names: OAC1/ 97.38% (existing batch purity), OAC1, OAC-1, OAC-1, >98.0%(GC), OAC1 99%. Offered by: TargetMol, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
N-(1H-pyrrolo[2,3-c]pyridin-5-yl)benzamide (CAS 300586-90-7) is a chemical compound with the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. IUPAC name: N-(1H-pyrrolo[2,3-c]pyridin-5-yl)benzamide. InChIKey: HWJRIFZDXJKJJN-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O |
|---|---|
| Molecular weight | 237.26 g/mol |
| IUPAC name | N-(1H-pyrrolo[2,3-c]pyridin-5-yl)benzamide |
| InChIKey | HWJRIFZDXJKJJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=NC=C3C(=C2)C=CN3 |
Computed by PubChem (NCBI)