CAS 182564-41-6 appears in our catalog under these names: OAC3/ 97.13% (existing batch purity), OAC3, OAC-3, >95.0%(GC), N-(4-Fluorobenzoyl)-5-amino-1H-indole, 97%, 97%, Oct4 inducer-1, 99.92%. Offered by: TargetMol, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg, 1g.
4-fluoro-N-(1H-indol-5-yl)benzamide (CAS 182564-41-6) is a chemical compound with the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. IUPAC name: 4-fluoro-N-(1H-indol-5-yl)benzamide. InChIKey: RQJUZWRDCVBOMH-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 4-fluoro-N-(1H-indol-5-yl)benzamide |
| InChIKey | RQJUZWRDCVBOMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC3=C(C=C2)NC=C3)F |
Computed by PubChem (NCBI)