cas: 70136-02-6 — see every product listed under this CAS number, including other names
Octyl nicotinate, 98.0%, 98.0% (CAS 70136-02-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114T0I-5g |
| cas | 70136-02-6 |
| size | 5g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 1442.00 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
Octyl pyridine-3-carboxylate (CAS 70136-02-6) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: octyl pyridine-3-carboxylate. InChIKey: TYBQVEHLLOHMLT-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | octyl pyridine-3-carboxylate |
| InChIKey | TYBQVEHLLOHMLT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)