Products 70136-02-6
CAS 70136-02-6 appears in our catalog under these names: Nicotinic acid n-octyl ester, 97%, Octyl nicotinate, 98%, n–Octyl Nicotinate, n-Octyl Nicotinate, >98.0%(GC), Octyl nicotinate, 98.0%, 98.0%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 100g, 1g, 25g, 5g, 250mg, 10g.
Octyl pyridine-3-carboxylate (CAS 70136-02-6) is a chemical compound with the molecular formula C14H21NO2 and a molecular weight of 235.32 g/mol. IUPAC name: octyl pyridine-3-carboxylate. InChIKey: TYBQVEHLLOHMLT-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2 |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | octyl pyridine-3-carboxylate |
| InChIKey | TYBQVEHLLOHMLT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)