CAS 101622-51-9 appears in our catalog under these names: Olomoucine/ 99.8% (existing batch purity), Olomoucine, Olomoucine 99%, Olomoucine 1PC X 5MG, Olomoucine, 99%, 99%. Offered by: TargetMol, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[6-(benzylamino)-9-methylpurin-2-yl]amino]ethanol (CAS 101622-51-9) is a chemical compound with the molecular formula C15H18N6O and a molecular weight of 298.34 g/mol. IUPAC name: 2-[[6-(benzylamino)-9-methylpurin-2-yl]amino]ethanol. InChIKey: GTVPOLSIJWJJNY-UHFFFAOYSA-N.
| Molecular formula | C15H18N6O |
|---|---|
| Molecular weight | 298.34 g/mol |
| IUPAC name | 2-[[6-(benzylamino)-9-methylpurin-2-yl]amino]ethanol |
| InChIKey | GTVPOLSIJWJJNY-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(N=C(N=C21)NCCO)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)