cas: 1508-65-2 — see every product listed under this CAS number, including other names
Oxybutynin chloride 99% (CAS 1508-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A586213-1mg |
| cas | 1508-65-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 693.00 Pln | |
| Ambeed | 25g | 2250.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A586213 |
4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride (CAS 1508-65-2) is a chemical compound with the molecular formula C22H32ClNO3 and a molecular weight of 393.9 g/mol. IUPAC name: 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride. InChIKey: SWIJYDAEGSIQPZ-UHFFFAOYSA-N.
| Molecular formula | C22H32ClNO3 |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride |
| InChIKey | SWIJYDAEGSIQPZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCOC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)