Products 1185151-95-4
CAS 1185151-95-4 appears in our catalog under these names: Oxybutynin-d11 Chloride, >95% (HPLC), Oxybutynin-d11 HCl, (±)-Oxybutynin-d11 HCl (cyclohexyl-d11), 99 atom % D, min 98% Chemical Purity, Oxybutynin-d11 chloride, Oxybutynin-d11 (chloride), 97.50%. Offered by: TRC, Chemat Brand, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, on request, 0,05g, 0,01g, 5mg, 50mg.
4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)acetate;hydrochloride (CAS 1185151-95-4) is a chemical compound with the molecular formula C22H32ClNO3 and a molecular weight of 405.0 g/mol. IUPAC name: 4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)acetate;hydrochloride. InChIKey: SWIJYDAEGSIQPZ-JPELPYLWSA-N.
| Molecular formula | C22H32ClNO3 |
|---|---|
| Molecular weight | 405.0 g/mol |
| IUPAC name | 4-(diethylamino)but-2-ynyl 2-hydroxy-2-phenyl-2-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)acetate;hydrochloride |
| InChIKey | SWIJYDAEGSIQPZ-JPELPYLWSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])C(C2=CC=CC=C2)(C(=O)OCC#CCN(CC)CC)O)([2H])[2H])([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)