CAS 1508-65-2 appears in our catalog under these names: Oxybutynin HCl, Oxybutynin Chloride, Oxybutynin Hydrochloride, Oxybutynin chloride, Oxybutynin chloride/ 99.17% (existing batch purity). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, GLPBio. Available pack sizes: on request, 1g, 25g, 500mg, 250mg, 10mg, 100mg, 10mM (in 1ml dmso).
4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride (CAS 1508-65-2) is a chemical compound with the molecular formula C22H32ClNO3 and a molecular weight of 393.9 g/mol. IUPAC name: 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride. InChIKey: SWIJYDAEGSIQPZ-UHFFFAOYSA-N.
| Molecular formula | C22H32ClNO3 |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;hydrochloride |
| InChIKey | SWIJYDAEGSIQPZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC#CCOC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)