CAS 71727-40-7 appears in our catalog under these names: P18IN003, 98%, P18IN003/ 98.77% (existing batch purity), P18IN003, 4,5-Bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one, P18IN003 99%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 500mg, 250mg.
4,5-bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one (CAS 71727-40-7) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 4,5-bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one. InChIKey: JOTSGKDUQMLZLE-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 4,5-bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one |
| InChIKey | JOTSGKDUQMLZLE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(NC(=O)N2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)