CAS 494763-64-3 appears in our catalog under these names: 5-Bromo-3-pyridinecarboxylic acid 2-(3-chlorophenyl)hydrazide, 98%, 98%, PDCD4-IN-1/ 99.21% (existing batch purity), PDCD4–IN–1, PDCD4-IN-1 98%, PDCD4-IN-1, 99.41%. Offered by: Chemat, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 5mg, 10mg, 500mg, 50 mg.
5-bromo-N'-(3-chlorophenyl)pyridine-3-carbohydrazide (CAS 494763-64-3) is a chemical compound with the molecular formula C12H9BrClN3O and a molecular weight of 326.57 g/mol. IUPAC name: 5-bromo-N'-(3-chlorophenyl)pyridine-3-carbohydrazide. InChIKey: VYRKESGWNTVDIT-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClN3O |
|---|---|
| Molecular weight | 326.57 g/mol |
| IUPAC name | 5-bromo-N'-(3-chlorophenyl)pyridine-3-carbohydrazide |
| InChIKey | VYRKESGWNTVDIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NNC(=O)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)