cas: 886469-23-4 — see every product listed under this CAS number, including other names
PEG8-Tos 95% (CAS 886469-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751766-250mg |
| cas | 886469-23-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 426.00 Pln | |
| Ambeed | 5g | 1844.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751766 |
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 886469-23-4) is a chemical compound with the molecular formula C23H40O11S and a molecular weight of 524.6 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: WJRLJFKBPYKOHJ-UHFFFAOYSA-N.
| Molecular formula | C23H40O11S |
|---|---|
| Molecular weight | 524.6 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | WJRLJFKBPYKOHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)