Products 936345-35-6
CAS 936345-35-6 appears in our catalog under these names: PF-02413873/ 100%, PF–02413873, PF-02413873, PF-02413873, 99.88%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
4-[3-cyclopropyl-5-methyl-1-(methylsulfonylmethyl)pyrazol-4-yl]oxy-2,6-dimethylbenzonitrile (CAS 936345-35-6) is a chemical compound with the molecular formula C18H21N3O3S and a molecular weight of 359.4 g/mol. IUPAC name: 4-[3-cyclopropyl-5-methyl-1-(methylsulfonylmethyl)pyrazol-4-yl]oxy-2,6-dimethylbenzonitrile. InChIKey: QSFGZNVRVZHUGV-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O3S |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-[3-cyclopropyl-5-methyl-1-(methylsulfonylmethyl)pyrazol-4-yl]oxy-2,6-dimethylbenzonitrile |
| InChIKey | QSFGZNVRVZHUGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C#N)C)OC2=C(N(N=C2C3CC3)CS(=O)(=O)C)C |
Computed by PubChem (NCBI)
Synonyms:
starbld0000789, orb1304956