CAS 1811510-56-1 appears in our catalog under these names: PF-06260933/ 99.52% (existing batch purity), PF–06260933, PF-06260933 98%, PF-06260933, ≥98%, ≥98%, PF-06260933, 99.39%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-(6-amino-3-pyridinyl)-3-(4-chlorophenyl)pyridin-2-amine (CAS 1811510-56-1) is a chemical compound with the molecular formula C16H13ClN4 and a molecular weight of 296.75 g/mol. IUPAC name: 5-(6-amino-3-pyridinyl)-3-(4-chlorophenyl)pyridin-2-amine. InChIKey: KHPCIHZXOGHCLY-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN4 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 5-(6-amino-3-pyridinyl)-3-(4-chlorophenyl)pyridin-2-amine |
| InChIKey | KHPCIHZXOGHCLY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CC(=C2)C3=CN=C(C=C3)N)N)Cl |
Computed by PubChem (NCBI)