CAS 813447-40-4 appears in our catalog under these names: PF-184298/ 98.3% (existing batch purity), PF-184298. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 2mg, 10 mg, 5 mg.
2,3-dichloro-N-(2-methylpropyl)-N-[(3S)-pyrrolidin-3-yl]benzamide (CAS 813447-40-4) is a chemical compound with the molecular formula C15H20Cl2N2O and a molecular weight of 315.2 g/mol. IUPAC name: 2,3-dichloro-N-(2-methylpropyl)-N-[(3S)-pyrrolidin-3-yl]benzamide. InChIKey: PIKCALBGLDBAKK-NSHDSACASA-N.
| Molecular formula | C15H20Cl2N2O |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 2,3-dichloro-N-(2-methylpropyl)-N-[(3S)-pyrrolidin-3-yl]benzamide |
| InChIKey | PIKCALBGLDBAKK-NSHDSACASA-N |
| SMILES | CC(C)CN([C@H]1CCNC1)C(=O)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)