CAS 1462249-75-7 appears in our catalog under these names: PFK-158/ 98.58% (existing batch purity), PFK–158, PFK-158, PFK158 98%, PFK-158, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g.
(E)-1-pyridin-4-yl-3-[7-(trifluoromethyl)quinolin-2-yl]prop-2-en-1-one (CAS 1462249-75-7) is a chemical compound with the molecular formula C18H11F3N2O and a molecular weight of 328.3 g/mol. IUPAC name: (E)-1-pyridin-4-yl-3-[7-(trifluoromethyl)quinolin-2-yl]prop-2-en-1-one. InChIKey: IAJOMYABKVAZCN-AATRIKPKSA-N.
| Molecular formula | C18H11F3N2O |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (E)-1-pyridin-4-yl-3-[7-(trifluoromethyl)quinolin-2-yl]prop-2-en-1-one |
| InChIKey | IAJOMYABKVAZCN-AATRIKPKSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)/C=C/C(=O)C3=CC=NC=C3)C(F)(F)F |
Computed by PubChem (NCBI)