CAS 1558598-41-6 appears in our catalog under these names: PFM 01, PFM01/ 99.76% (existing batch purity), PFM01, PFM01 98+%, PFM01, 98+%, 98+%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 200mg, 250mg, 1g.
(5Z)-5-[(4-hydroxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1558598-41-6) is a chemical compound with the molecular formula C14H15NO2S2 and a molecular weight of 293.4 g/mol. IUPAC name: (5Z)-5-[(4-hydroxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: GPURHDUTZUYAFI-GHXNOFRVSA-N.
| Molecular formula | C14H15NO2S2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-3-(2-methylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | GPURHDUTZUYAFI-GHXNOFRVSA-N |
| SMILES | CC(C)CN1C(=O)/C(=C/C2=CC=C(C=C2)O)/SC1=S |
Computed by PubChem (NCBI)