Products 668468-50-6
CAS 668468-50-6 is the registry number for 1-(Phenylsulfonyl)-2-(thiophen-2-yl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(benzenesulfonyl)-2-thiophen-2-ylpyrrolidine (CAS 668468-50-6) is a chemical compound with the molecular formula C14H15NO2S2 and a molecular weight of 293.4 g/mol. IUPAC name: 1-(benzenesulfonyl)-2-thiophen-2-ylpyrrolidine. InChIKey: CFOXKOYGJCNBDS-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-2-thiophen-2-ylpyrrolidine |
| InChIKey | CFOXKOYGJCNBDS-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)S(=O)(=O)C2=CC=CC=C2)C3=CC=CS3 |
Computed by PubChem (NCBI)