cas: 102271-49-8 — see every product listed under this CAS number, including other names
PGS-IN-1 99% (CAS 102271-49-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1188681-1mg |
| cas | 102271-49-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 470.50 Pln | |
| Ambeed | 5mg | 553.94 Pln | |
| Ambeed | 10mg | 915.50 Pln | |
| Ambeed | 25mg | 1877.81 Pln | |
| Ambeed | 50mg | 3251.75 Pln | |
| Ambeed | 100mg | 4848.19 Pln | |
| Ambeed | 250mg | 7390.25 Pln | |
| Ambeed | 1g | 8864.31 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1188681 |
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one (CAS 102271-49-8) is a chemical compound with the molecular formula C19H26O3 and a molecular weight of 302.4 g/mol. IUPAC name: (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one. InChIKey: DFPYHQJPGCODSB-UKTHLTGXSA-N.
| Molecular formula | C19H26O3 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one |
| InChIKey | DFPYHQJPGCODSB-UKTHLTGXSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/2\CCOC2=O |
Computed by PubChem (NCBI)