CAS 84030-86-4 is the registry number for Esbiothrin. Offered by: Chemat Brand. Available pack sizes: on request.
Allethrin is a cyclopropanecarboxylate ester. It has a role as a pyrethroid ester insecticide. It is functionally related to a chrysanthemic acid.
Source: ChEBI
| Molecular formula | C19H26O3 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (2-methyl-4-oxo-3-prop-2-enylcyclopent-2-en-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | ZCVAOQKBXKSDMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)CC1OC(=O)C2C(C2(C)C)C=C(C)C)CC=C |
Computed by PubChem (NCBI)