CAS 102271-49-8 appears in our catalog under these names: (E)-3-(3,5-Di-tert-butyl-4-hydroxybenzylidene)dihydrofuran-2(3h)-one, 95%, PGS-IN-1/ 99.67% (existing batch purity), PGS–IN–1 (KME–4), PGS-IN-1 99%, (E)-3-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]dihydro-2(3H)-furanone. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
(3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one (CAS 102271-49-8) is a chemical compound with the molecular formula C19H26O3 and a molecular weight of 302.4 g/mol. IUPAC name: (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one. InChIKey: DFPYHQJPGCODSB-UKTHLTGXSA-N.
| Molecular formula | C19H26O3 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | (3E)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]oxolan-2-one |
| InChIKey | DFPYHQJPGCODSB-UKTHLTGXSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)/C=C/2\CCOC2=O |
Computed by PubChem (NCBI)