CAS 2009343-14-8 appears in our catalog under these names: PHD-1-IN-1, PHD–1–IN–1, PHD-1-IN-1, 99.54%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)benzonitrile (CAS 2009343-14-8) is a chemical compound with the molecular formula C13H8N4 and a molecular weight of 220.23 g/mol. IUPAC name: 4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)benzonitrile. InChIKey: DEYMFBHALUHGST-UHFFFAOYSA-N.
| Molecular formula | C13H8N4 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)benzonitrile |
| InChIKey | DEYMFBHALUHGST-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=NN2C(=C1)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)