CAS 1394402-09-5 is the registry number for 1-(Pyrimidin-2-yl)-1H-indole-2-carbonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
1-pyrimidin-2-ylindole-2-carbonitrile (CAS 1394402-09-5) is a chemical compound with the molecular formula C13H8N4 and a molecular weight of 220.23 g/mol. IUPAC name: 1-pyrimidin-2-ylindole-2-carbonitrile. InChIKey: YXZQSSOTOTWZLW-UHFFFAOYSA-N.
| Molecular formula | C13H8N4 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 1-pyrimidin-2-ylindole-2-carbonitrile |
| InChIKey | YXZQSSOTOTWZLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2C3=NC=CC=N3)C#N |
Computed by PubChem (NCBI)