CAS 52109-67-8 is the registry number for 2,3-Dicyano-6-methyl-5-phenylpyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-methyl-6-phenylpyrazine-2,3-dicarbonitrile (CAS 52109-67-8) is a chemical compound with the molecular formula C13H8N4 and a molecular weight of 220.23 g/mol. IUPAC name: 5-methyl-6-phenylpyrazine-2,3-dicarbonitrile. InChIKey: YKYXESCSPXPMKE-UHFFFAOYSA-N.
| Molecular formula | C13H8N4 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 5-methyl-6-phenylpyrazine-2,3-dicarbonitrile |
| InChIKey | YKYXESCSPXPMKE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C#N)C#N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)