Products 1013098-90-2
CAS 1013098-90-2 appears in our catalog under these names: PI3Kα/mTOR-IN-1/ 99.3% (existing batch purity), PI3Kα/mTOR-IN-1, PI3Kα/mTOR-IN-1, 99.30%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)pyrido[2,3-d]pyrimidin-7-one (CAS 1013098-90-2) is a chemical compound with the molecular formula C16H18N6O and a molecular weight of 310.35 g/mol. IUPAC name: 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)pyrido[2,3-d]pyrimidin-7-one. InChIKey: VMGMCPMGGFUNMP-UHFFFAOYSA-N.
| Molecular formula | C16H18N6O |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)pyrido[2,3-d]pyrimidin-7-one |
| InChIKey | VMGMCPMGGFUNMP-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=O)N(C2=NC(=N1)N)C3CCCC3)C4=CNN=C4 |
Computed by PubChem (NCBI)