PROTAC ERRα ligand 2
cas: 2306388-57-6 — see every product listed under this CAS number, including other names
PROTAC ERRα ligand 2 (CAS 2306388-57-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 25mg, 200mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC38383-10 |
| cas | 2306388-57-6 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1467.61 Pln | |
| GLPBio | 100mg | 5469.44 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1247.63 Pln | |
| GLPBio | 5mg | 1172.74 Pln | |
| GLPBio | 50mg | 3447.46 Pln | |
| Chemat | 1mg | 304.40 Pln | |
| Chemat | 5mg | 659.60 Pln | |
| Chemat | 10mg | 866.00 Pln | |
| Chemat | 25mg | 1504.40 Pln | |
| Chemat | 50mg | 2166.80 Pln | |
| Chemat | 100mg | 2910.80 Pln | |
| Chemat | 200mg | 3904.40 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid (CAS 2306388-57-6) is a chemical compound with the molecular formula C20H13F6NO4 and a molecular weight of 445.3 g/mol. IUPAC name: (E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid. InChIKey: JRWKJGIKIBTXMV-AWNIVKPZSA-N.
| Molecular formula | C20H13F6NO4 |
|---|---|
| Molecular weight | 445.3 g/mol |
| IUPAC name | (E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid |
| InChIKey | JRWKJGIKIBTXMV-AWNIVKPZSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C(\C#N)/C(=O)O)OCC2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)