Products 2306388-57-6

CAS 2306388-57-6 appears in our catalog under these names: Protac erralpha ligand 2, 95%, PROTAC ERRα ligand 2/ 98%, PROTAC ERRα ligand 2, PROTAC ERRα ligand 2, PROTAC ERRα ligand 2, 99.36%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid (CAS 2306388-57-6) is a chemical compound with the molecular formula C20H13F6NO4 and a molecular weight of 445.3 g/mol. IUPAC name: (E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid. InChIKey: JRWKJGIKIBTXMV-AWNIVKPZSA-N.

Identity
Molecular formulaC20H13F6NO4
Molecular weight445.3 g/mol
IUPAC name(E)-3-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-2-cyanoprop-2-enoic acid
InChIKeyJRWKJGIKIBTXMV-AWNIVKPZSA-N
SMILESCOC1=C(C=CC(=C1)/C=C(\C#N)/C(=O)O)OCC2=C(C=C(C=C2)C(F)(F)F)C(F)(F)F

Computed by PubChem (NCBI)