CAS 388575-52-8 appears in our catalog under these names: PSN 375963/ 99.24% (existing batch purity), PSN 375963 hydrochloride, PSN 375963 99%, PSN375963, PSN 375963, 99.95%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
5-(4-butylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole (CAS 388575-52-8) is a chemical compound with the molecular formula C17H23N3O and a molecular weight of 285.4 g/mol. IUPAC name: 5-(4-butylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole. InChIKey: OAVLEYPTWABFLF-UHFFFAOYSA-N.
| Molecular formula | C17H23N3O |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 5-(4-butylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| InChIKey | OAVLEYPTWABFLF-UHFFFAOYSA-N |
| SMILES | CCCCC1CCC(CC1)C2=NC(=NO2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)