Products 349093-44-3
CAS 349093-44-3 appears in our catalog under these names: PTGR2–IN–1, PTGR2-IN-1/ 99.85% (existing batch purity), PTGR2-IN-1, 1-(4-(2-Methoxyphenyl)piperazin-1-yl)-2-phenylethanone, 99%, 99%, PTGR2-IN-1, 99.82%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 200mg, 250mg.
1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylethanone (CAS 349093-44-3) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylethanone. InChIKey: TVIOYMPBWXQRRQ-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-2-phenylethanone |
| InChIKey | TVIOYMPBWXQRRQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)C(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)