cas: 10605-02-4 — see every product listed under this CAS number, including other names
Palmatine chloride, 97% (CAS 10605-02-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250MG, 100mg, 5g, 25g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 467150010 |
| cas | 10605-02-4 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 1434.33 Pln | |
| Thermo Scientific (Acros) | 250MG | 458.81 Pln | |
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 100g | 820.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride (CAS 10605-02-4) is a chemical compound with the molecular formula C21H22ClNO4 and a molecular weight of 387.9 g/mol. IUPAC name: 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride. InChIKey: RLQYRXCUPVKSAW-UHFFFAOYSA-M.
| Molecular formula | C21H22ClNO4 |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium chloride |
| InChIKey | RLQYRXCUPVKSAW-UHFFFAOYSA-M |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-] |
Computed by PubChem (NCBI)