Products 1346606-71-0
CAS 1346606-71-0 appears in our catalog under these names: Dimethomorph-d8, >95% (HPLC), Dimethomorph-d8 (morpholine-d8) (E/Z mixture), 99 atom % D, min 98% Chemical Purity, Dimethomorph-d8, D8-Dimethomorph, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 2,5mg, 25mg, 0,01g, 0,005g, 2.5 mg, 25 mg, 1x1ml.
(E)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)prop-2-en-1-one (CAS 1346606-71-0) is a chemical compound with the molecular formula C21H22ClNO4 and a molecular weight of 395.9 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)prop-2-en-1-one. InChIKey: QNBTYORWCCMPQP-RLTCFVBRSA-N.
| Molecular formula | C21H22ClNO4 |
|---|---|
| Molecular weight | 395.9 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)prop-2-en-1-one |
| InChIKey | QNBTYORWCCMPQP-RLTCFVBRSA-N |
| SMILES | [2H]C1(C(OC(C(N1C(=O)/C=C(\C2=CC=C(C=C2)Cl)/C3=CC(=C(C=C3)OC)OC)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)