CAS 110488-70-5 appears in our catalog under these names: Dimethomorph, 95%, Dimethomorph, Dimethomorph, >95% (HPLC), Dimethomorph 10 µg/mL in Acetonitrile, Dimethomorph 10 µg/mL in Cyclohexane. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 250mg, 1g, 100mg, on request, 10g, 500mg, 10ml, 1ml.
3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one (CAS 110488-70-5) is a chemical compound with the molecular formula C21H22ClNO4 and a molecular weight of 387.9 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one. InChIKey: QNBTYORWCCMPQP-UHFFFAOYSA-N.
| Molecular formula | C21H22ClNO4 |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-morpholin-4-ylprop-2-en-1-one |
| InChIKey | QNBTYORWCCMPQP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=CC(=O)N2CCOCC2)C3=CC=C(C=C3)Cl)OC |
Computed by PubChem (NCBI)