CAS 914913-88-5 appears in our catalog under these names: Palomid 529, Palomid 529/ 99.03% (existing batch purity), Palomid 529 98+%, Palomid 529 (Standard), Palomid 529, 99.37%. Offered by: GLPBio, TargetMol, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 500mg, 250mg.
8-(1-hydroxyethyl)-2-methoxy-3-[(4-methoxyphenyl)methoxy]benzo[c]chromen-6-one (CAS 914913-88-5) is a chemical compound with the molecular formula C24H22O6 and a molecular weight of 406.4 g/mol. IUPAC name: 8-(1-hydroxyethyl)-2-methoxy-3-[(4-methoxyphenyl)methoxy]benzo[c]chromen-6-one. InChIKey: YEAHTLOYHVWAKW-UHFFFAOYSA-N.
| Molecular formula | C24H22O6 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 8-(1-hydroxyethyl)-2-methoxy-3-[(4-methoxyphenyl)methoxy]benzo[c]chromen-6-one |
| InChIKey | YEAHTLOYHVWAKW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C3=CC(=C(C=C3OC2=O)OCC4=CC=C(C=C4)OC)OC)O |
Computed by PubChem (NCBI)