cas: 61-25-6 — see every product listed under this CAS number, including other names
Papaverine hydrochloride, 99% (CAS 61-25-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 207220050 |
| cas | 61-25-6 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 271.72 Pln | |
| Thermo Scientific (Acros) | 25g | 846.35 Pln | |
| Thermo Scientific (Acros) | 100g | 2049.05 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride (CAS 61-25-6) is a chemical compound with the molecular formula C20H22ClNO4 and a molecular weight of 375.8 g/mol. IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride. InChIKey: UOTMYNBWXDUBNX-UHFFFAOYSA-N.
| Molecular formula | C20H22ClNO4 |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline;hydrochloride |
| InChIKey | UOTMYNBWXDUBNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC.Cl |
Computed by PubChem (NCBI)