CAS 2157488-46-3 appears in our catalog under these names: Bezafibrate EP Impurity C, Methyl 2-(4-(2-((4-Chloro-benzoyl)amino)ethyl)phenoxy)-2-methylpropanoate. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 4x25mg, 25mg.
Methyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate (CAS 2157488-46-3) is a chemical compound with the molecular formula C20H22ClNO4 and a molecular weight of 375.8 g/mol. IUPAC name: methyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate. InChIKey: KDYYGGKDZBRIIX-UHFFFAOYSA-N.
| Molecular formula | C20H22ClNO4 |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | methyl 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoate |
| InChIKey | KDYYGGKDZBRIIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)