Products 51771-50-7
CAS 51771-50-7 is the registry number for Fenicoberan. Offered by: Biosynth. Available pack sizes: 1g, 10g.
Ethyl 4-[(dimethylamino)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride (CAS 51771-50-7) is a chemical compound with the molecular formula C20H22ClNO4 and a molecular weight of 375.8 g/mol. IUPAC name: ethyl 4-[(dimethylamino)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride. InChIKey: OBTUDMCEULZBKV-UHFFFAOYSA-N.
| Molecular formula | C20H22ClNO4 |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | ethyl 4-[(dimethylamino)methyl]-5-hydroxy-2-phenyl-1-benzofuran-3-carboxylate;hydrochloride |
| InChIKey | OBTUDMCEULZBKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC2=C1C(=C(C=C2)O)CN(C)C)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)