CAS 57046-73-8 appears in our catalog under these names: Paprotrain, 95%, Paprotrain, 98%, Paprotrain/ 99.69% (existing batch purity), Paprotrain, Paprotrain, >95.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, TCI. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 500mg, 1mg.
(Z)-2-(1H-indol-3-yl)-3-pyridin-3-ylprop-2-enenitrile (CAS 57046-73-8) is a chemical compound with the molecular formula C16H11N3 and a molecular weight of 245.28 g/mol. IUPAC name: (Z)-2-(1H-indol-3-yl)-3-pyridin-3-ylprop-2-enenitrile. InChIKey: YMYYQRZCCKBFBE-MDWZMJQESA-N.
| Molecular formula | C16H11N3 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | (Z)-2-(1H-indol-3-yl)-3-pyridin-3-ylprop-2-enenitrile |
| InChIKey | YMYYQRZCCKBFBE-MDWZMJQESA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C(=C/C3=CN=CC=C3)/C#N |
Computed by PubChem (NCBI)